| Name |
Ulexone A 5,7-Dihydroxy-8-prenyl-6'',6''-dimethylpyrano[2'',3'':4',3']isoflavone |
| Formula |
C25H24O5 |
| Mw |
404.16237388 |
| CAS RN |
128988-20-5 |
| C_ID |
C00009935
, 
|
| InChIKey |
ZPJWXFWZRLIDMC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H24O5/c1-14(2)5-7-17-19(26)12-20(27)22-23(28)18(13-29-24(17)22)15-6-8-21-16(11-15)9-10-25(3,4)30-21/h5-6,8-13,26-27H,7H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c(-c3ccc4c(c3)C=CC(C)(C)O4)coc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
|
|
zoom in
| Organism | Ulex europaeus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Russell,Phytochem.,29,(1990),1287 |
|---|
|