| Name |
Garhwalin |
| Formula |
C19H12O6 |
| Mw |
336.06338812 |
| CAS RN |
113023-68-0 |
| C_ID |
C00009909
, 
|
| InChIKey |
HEOAJOAZVYRLMA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H12O6/c1-21-16-7-14-11(4-5-22-14)19-17(16)18(20)12(8-23-19)10-2-3-13-15(6-10)25-9-24-13/h2-8H,9H2,1H3 |
| SMILES |
COc1cc2occc2c2occ(-c3ccc4c(c3)OCO4)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Celastraceae | Euonymus pendulus  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Euonymus pendulus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dobhal,Pharmazie,42,(1987),558 |
|---|
|