| Name |
Hydroxywighteone 5,7,4'-Trihydroxy-6-(3-hydroxymethyl-2-butenyl)isoflavone Glabrisoflavone Isogancaonin C |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
104691-87-4 |
| C_ID |
C00009892
, 
|
| InChIKey |
AROTXIUFXQZGLT-BIIKFXOESA-N |
| InChICode |
InChI=1S/C20H18O6/c1-11(9-21)2-7-14-16(23)8-17-18(19(14)24)20(25)15(10-26-17)12-3-5-13(22)6-4-12/h2-6,8,10,21-24H,7,9H2,1H3/b11-2+ |
| SMILES |
C/C(=CCc1c(O)cc2occ(-c3ccc(O)cc3)c(=O)c2c1O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
|
|
zoom in
| Organism | Lupinus luteus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hashidoko,Agric.Biol.Chem.,50,(1986),1797 |
|---|
|