| Name |
5,7-Dihydroxy-2',6-dimethoxyisoflavone 5,7-Dihydroxy-6,2'-dimethoxyisoflavone |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
94285-21-9 |
| C_ID |
C00009825
, 
|
| InChIKey |
AELVNGRVQZQCDD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-12-6-4-3-5-9(12)10-8-23-13-7-11(18)17(22-2)16(20)14(13)15(10)19/h3-8,18,20H,1-2H3 |
| SMILES |
COc1ccccc1-c1coc2cc(O)c(OC)c(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pericopsis laxiflora  | Ref. |
| Plantae | Iridaceae | Iris crocea | Ref. |
| Plantae | Iridaceae | Iris spuria | Ref. |
| Plantae | Iridaceae | Iris tenuifolia | Ref. |
|
|
zoom in
| Organism | Iris spuria | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Shawl,Phytochem.,23,(1984),2405 |
|---|
|