| Name |
Glycyrin 3-(2,4-Dihydroxyphenyl)-5,7-dimethoxy-6-prenylcoumarin |
| Formula |
C22H22O6 |
| Mw |
382.14163844 |
| CAS RN |
66056-18-6 |
| C_ID |
C00009785
, 
|
| InChIKey |
FWWGXZYUURXJLK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H22O6/c1-12(2)5-7-15-19(26-3)11-20-17(21(15)27-4)10-16(22(25)28-20)14-8-6-13(23)9-18(14)24/h5-6,8-11,23-24H,7H2,1-4H3 |
| SMILES |
COc1cc2oc(=O)c(-c3ccc(O)cc3O)cc2c(OC)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza sp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kinoshita,Chem.Pharm.Bull.,26,(1978),135 |
|---|
|