| Name |
Pachyrrhizin Neorautone |
| Formula |
C19H12O6 |
| Mw |
336.06338812 |
| CAS RN |
10091-01-7 |
| C_ID |
C00009783
, 
|
| InChIKey |
PENSQRMNZZWMGV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H12O6/c1-21-16-8-18-17(23-9-24-18)6-12(16)13-5-11-4-10-2-3-22-14(10)7-15(11)25-19(13)20/h2-8H,9H2,1H3 |
| SMILES |
COc1cc2c(cc1-c1cc3cc4ccoc4cc3oc1=O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
| Plantae | Fabaceae | Neorautanenia edulis | Ref. |
| Plantae | Fabaceae | Neorautanenia pseudopachyrrhiza | Ref. |
| Plantae | Fabaceae | Pachyrhizus tuberosus  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
|
|
zoom in
| Organism | Neorautanenia pseudopachyrrhiza | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Van Duuren,J.Org.Chem.,26,(1961),5013
Simonitsch,Monatsh.Chem.,88,(1957),541 |
|---|
|