| Name |
Demethylwedelolactone Norwedelolactone Desmethylwedelolactone |
| Formula |
C15H8O7 |
| Mw |
300.02700261 |
| CAS RN |
6468-55-9 |
| C_ID |
C00009765
, 
|
| InChIKey |
LUTYTNLPIUCKBJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O7/c16-5-1-9(19)13-11(2-5)22-15(20)12-6-3-7(17)8(18)4-10(6)21-14(12)13/h1-4,16-19H |
| SMILES |
O=c1oc2cc(O)cc(O)c2c2oc3cc(O)c(O)cc3c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eclipta alba  | Ref. |
| Plantae | Asteraceae | Eclipta prostrata  | Ref. |
| Plantae | Asteraceae | Wedelia calendulacea  | Ref. |
| Plantae | Asteraceae | Wedelia chinensis | Ref. |
| Plantae | Hypericaceae | Hypericum erectum | Ref. |
| - | - | Mnium hornum | Ref. |
|
|
zoom in
| Organism | Wedelia calendulacea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Bhargava,Indian J.Chem.,8,(1970),664
Bhargava,Indian J.Chem.,10,(1972),810 |
|---|
|