| Name |
Pendulone 7-Hydroxy-3',4'-dimethoxyisoflavanquinone |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
69359-09-7 |
| C_ID |
C00009742
, 
|
| InChIKey |
SHZOHJDZQPQBSW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-16-13(19)7-12(15(20)17(16)22-2)10-5-9-3-4-11(18)6-14(9)23-8-10/h3-4,6-7,10,18H,5,8H2,1-2H3/t10-/m0/s1 |
| SMILES |
COC1=C(OC)C(=O)C(C2COc3cc(O)ccc3C2)=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia dielsiana | Ref. |
| Plantae | Fabaceae | Millettia leucantha | Ref. |
| Plantae | Fabaceae | Millettia pendula | Ref. |
|
|
zoom in
| Organism | Millettia pendula | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hayashi,J.Jpn Wood Res.Soc.,24,(1978),898 |
|---|
|