| Name |
Demethylvestitol 7,2',4'-Trihydroxyisoflavan |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
65332-45-8 |
| C_ID |
C00009708
, 
|
| InChIKey |
CJZBXHPHEBCWLV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O4/c16-11-3-4-13(14(18)6-11)10-5-9-1-2-12(17)7-15(9)19-8-10/h1-4,6-7,10,16-18H,5,8H2/t10-/m0/s1 |
| SMILES |
Oc1ccc(C2COc3cc(O)ccc3C2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Anthyllis vulneraria  | Ref. |
| Plantae | Fabaceae | Erythrina sandwicensis | Ref. |
| Plantae | Fabaceae | Lotus spp. | Ref. |
| Plantae | Fabaceae | Lotus uliginosus | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| - | - | Hosackia americana | Ref. |
| - | - | Tetragonolobus spp. | Ref. |
|
|
zoom in
| Organism | Lotus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Phytochem.,16,(1977),1279
Ingham,Z.Naturforsch.C,35,(1980),384 |
|---|
|