| Name |
Sandwicensin 3-Hydroxy-9-methoxy-10-prenylpterocarpan |
| Formula |
C21H22O4 |
| Mw |
338.15180919 |
| CAS RN |
74515-46-1 |
| C_ID |
C00009644
, 
|
| InChIKey |
ZFUZIYGRFSXEIQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O4/c1-12(2)4-6-15-18(23-3)9-8-14-17-11-24-19-10-13(22)5-7-16(19)21(17)25-20(14)15/h4-5,7-10,17,21-22H,6,11H2,1-3H3/t17-,21-/m0/s1 |
| SMILES |
COc1ccc2c(c1CC=C(C)C)OC1c3ccc(O)cc3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina glauca | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina sandwicensis | Ref. |
| Plantae | Fabaceae | Erythrina x bidwillii | Ref. |
|
|
zoom in
| Organism | Erythrina sandwicensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Z.Naturforsch.C,35,(1980),384 |
|---|
|