| Name |
Stemonal |
| Formula |
C19H16O8 |
| Mw |
372.08451749 |
| CAS RN |
54357-82-3 |
| C_ID |
C00009596
, 
|
| InChIKey |
INRSYSTZYGIZOF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H16O8/c1-23-8-4-10(20)16-14(5-8)26-18-15(17(16)21)9-6-12(24-2)13(25-3)7-11(9)27-19(18)22/h4-7,19-20,22H,1-3H3/t19-/m0/s1 |
| SMILES |
COc1cc(O)c2c(=O)c3c(oc2c1)C(O)Oc1cc(OC)c(OC)cc1-3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Clitoria fairchildiana | Ref. |
| Plantae | Fabaceae | Millettia brandisiana | Ref. |
| Plantae | Stemonaceae | Stemona collinsae | Ref. |
|
|
zoom in
| Organism | Stemona collinsae |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Shiengthong,Tetrahedron Lett.,(1974),2015 |
|---|
|
