| Name |
Dolineone Dolichone |
| Formula |
C19H12O6 |
| Mw |
336.06338812 |
| CAS RN |
10065-28-8 |
| C_ID |
C00009568
, 
|
| InChIKey |
RAJDDCCSNZAPCH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H12O6/c20-19-11-3-9-1-2-21-12(9)5-14(11)25-17-7-22-13-6-16-15(23-8-24-16)4-10(13)18(17)19/h1-6,17-18H,7-8H2/t17-,18?/m0/s1 |
| SMILES |
O=C1c2cc3ccoc3cc2OC2COc3cc4c(cc3C12)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Neorautanenia mitis  | Ref. |
| Plantae | Fabaceae | Neorautanenia pseudopachyrrhiza | Ref. |
| Plantae | Fabaceae | Pachyrhizus erosus  | Ref. |
| Plantae | Fabaceae | Pachyrhizus tuberosus  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
|
|
zoom in
| Organism | Pachyrhizus erosus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Crombie,Tetrahedron Lett.,(1962),801
Crombie,J.Chem.Soc.,(1963),1569 |
|---|
|