| Name |
Parvisoflavone B |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
50277-02-6 |
| C_ID |
C00009498
, 
|
| InChIKey |
YKYNYMQDXOWMDT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-20(2)6-5-12-15(26-20)8-16-17(18(12)23)19(24)13(9-25-16)11-4-3-10(21)7-14(11)22/h3-9,21-23H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc3occ(-c4ccc(O)cc4O)c(=O)c3c2O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Eriophorum scheuchzeri | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Poecilanthe parviflora | Ref. |
|
|
zoom in
| Organism | Poecilanthe parviflora |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Assumpcao,Phytochem.,12,(1973),1188 |
|---|
|
