| Name |
Irisolone methyl ether 5,4'-Dimethoxy-6,7-methylenedioxyisoflavone 4',5-Dimethoxy-6,7-methylenedioxyisoflavone |
| Formula |
C18H14O6 |
| Mw |
326.07903818 |
| CAS RN |
3405-76-3 |
| C_ID |
C00009468
, 
|
| InChIKey |
LCIXCHCKTZRXMH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O6/c1-20-11-5-3-10(4-6-11)12-8-22-13-7-14-17(24-9-23-14)18(21-2)15(13)16(12)19/h3-8H,9H2,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc4c(c(OC)c3c2=O)OCO4)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Iridaceae | Iris japonica  | Ref. |
| Plantae | Iridaceae | Iris tingitana | Ref. |
| Plantae | Ochnaceae | Ochna afzelii  | Ref. |
|
|
zoom in
| Organism | Iris tingitana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
El-Emary,Phytochem.,19,(1980),1878 |
|---|
|