| Name |
7-O-Methyltectorigenin 5,4'-Dihydroxy-6,7-dimethoxyisoflavone |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
1096-58-8 |
| C_ID |
C00009463
, 
|
| InChIKey |
JDKYUORVNMYEIK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-13-7-12-14(16(20)17(13)22-2)15(19)11(8-23-12)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3 |
| SMILES |
COc1cc2occ(-c3ccc(O)cc3)c(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nervosa  | Ref. |
| Plantae | Fabaceae | Dalbergia monetaria  | Ref. |
| Plantae | Fabaceae | Dalbergia sissoo  | Ref. |
| Plantae | Fabaceae | Dalbergia spinosa | Ref. |
| Plantae | Fabaceae | Dalbergia spruceana | Ref. |
| Plantae | Fabaceae | Dalbergia volubilis  | Ref. |
| Plantae | Fabaceae | Pterocarpus angolensis  | Ref. |
|
|
zoom in
| Organism | Dalbergia sissoo | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Banerji,Indian J.Chem.,1,(1963),25
Morgan,Chem.Ind.(London),(1967),1173 |
|---|
|