| Name |
Cuneatin methyl ether 7,2'-Dimethoxy-4',5'-methylenedioxyisoflavon |
| Formula |
C18H14O6 |
| Mw |
326.07903818 |
| CAS RN |
4253-00-3 |
| C_ID |
C00009410
, 
|
| InChIKey |
MSPWKPQQHHCXLR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O6/c1-20-10-3-4-11-15(5-10)22-8-13(18(11)19)12-6-16-17(24-9-23-16)7-14(12)21-2/h3-8H,9H2,1-2H3 |
| SMILES |
COc1ccc2c(=O)c(-c3cc4c(cc3OC)OCO4)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Millettia griffoniana | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
| Plantae | Fabaceae | Tephrosia maxima | Ref. |
|
|
zoom in
| Organism | Pterodon apparicioi | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Galina,Phytochem.,13,(1974),2593 |
|---|
|