| Name |
Retusin(Dalbergia) 7,8-Dihydroxy-4'-methoxyisoflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
37816-19-6 |
| C_ID |
C00009393
, 
|
| InChIKey |
DLXIJJURUIXRFK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-16-11(14(12)18)6-7-13(17)15(16)19/h2-8,17,19H,1H3 |
| SMILES |
COc1ccc(-c2coc3c(O)c(O)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia retusa | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
|
|
zoom in
| Organism | Dipteryx odorata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hayashi,Phytochem.,13,(1974),1943 |
|---|
|