| Name |
7,4'-Di-O-methyldaidzein |
| Formula |
C17H14O4 |
| Mw |
282.08920894 |
| CAS RN |
1157-39-7 |
| C_ID |
C00009387
, 
|
| InChIKey |
LPNBCGIVZXHHHO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)15-10-21-16-9-13(20-2)7-8-14(16)17(15)18/h3-10H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc(OC)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Dalbergia violacea | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
|
|
zoom in
| Organism | Pterodon apparicioi | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Leite de Almeida,Phytochem.,14,(1975),2716 |
|---|
|