| Name |
Epigallocatechin-(4beta->8)-epigallocatechin-3-O-gallate |
| Formula |
C37H30O18 |
| Mw |
762.14321416 |
| CAS RN |
86588-88-7 |
| C_ID |
C00009238
, 
|
| InChIKey |
JSBXKZFDEDBAQA-DRGKFGJSNA-N |
| InChICode |
InChI=1S/C37H30O18/c38-14-7-17(40)27-25(8-14)53-35(12-3-21(44)31(49)22(45)4-12)33(51)29(27)28-18(41)10-16(39)15-9-26(54-37(52)13-5-23(46)32(50)24(47)6-13)34(55-36(15)28)11-1-19(42)30(48)20(43)2-11/h1-8,10,26,29,33-35,38-51H,9H2/t26-,29-,33-,34-,35-/m1/s1 |
| SMILES |
O=C(O[C@@H]1Cc2c(O)cc(O)c([C@H]3c4c(O)cc(O)cc4O[C@H](c4cc(O)c(O)c(O)c4)[C@@H]3O)c2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
| Plantae | Fabaceae | Stryphnodendron adstringens  | Ref. |
| Plantae | Myricaceae | Myrica esculenta  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
|
|
zoom in
| Organism | Mallotus japonicus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,Pharm.Bull.,31,(1983),3906
Nonaka,Phytochem.,22,(1983),237 |
|---|
|