| Name |
ent-Fisetinidol-(4alpha->8)-catechin-(6->4alpha)-ent-fisetinidol |
| Formula |
C45H38O16 |
| Mw |
834.21598517 |
| CAS RN |
88269-49-2 |
| C_ID |
C00009152
, 
|
| InChIKey |
VYURQCQMACPHRC-HDMLTQLQNA-N |
| InChICode |
InChI=1S/C45H38O16/c46-20-4-6-22-32(14-20)59-43(18-2-9-26(49)29(52)12-18)40(57)34(22)36-38(55)24-16-31(54)42(17-1-8-25(48)28(51)11-17)61-45(24)37(39(36)56)35-23-7-5-21(47)15-33(23)60-44(41(35)58)19-3-10-27(50)30(53)13-19/h1-15,31,34-35,40-44,46-58H,16H2/t31-,34+,35+,40-,41-,42-,43+,44+/m1/s1 |
| SMILES |
Oc1ccc2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@H](O)[C@@H]2c1c(O)c2c(c([C@@H]3c4ccc(O)cc4O[C@@H](c4ccc(O)c(O)c4)[C@@H]3O)c1O)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus leptodictya | Ref. |
| Plantae | Anacardiaceae | Schinopsis balansae  | Ref. |
| Plantae | Anacardiaceae | Schinopsis lorentzii  | Ref. |
|
|
zoom in
| Organism | Schinopsis lorentzii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Viviers,J.Chem.Soc.Perkin Trans.,1,(1983),2555 |
|---|
|