| Name |
Peltogynan-4-alpha-ol |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
14894-93-0 |
| C_ID |
C00009039
, 
|
| InChIKey |
OPWUVOPHCMWWGJ-MCUZVLRKNA-N |
| InChICode |
InChI=1S/C16H14O6/c17-8-1-2-9-13(4-8)22-15-10-5-12(19)11(18)3-7(10)6-21-16(15)14(9)20/h1-5,14-20H,6H2/t14-,15+,16+/m1/s1 |
| SMILES |
Oc1ccc2c(c1)O[C@@H]1c3cc(O)c(O)cc3CO[C@H]1[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia carnei | Ref. |
| Plantae | Fabaceae | Acacia crombei | Ref. |
| Plantae | Fabaceae | Acacia fasciculifera | Ref. |
| Plantae | Fabaceae | Acacia peuce | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Hymenaea verrucosa | Ref. |
| Plantae | Fabaceae | Peltogyne catingae | Ref. |
| Plantae | Fabaceae | Peltogyne confertiflora | Ref. |
| Plantae | Fabaceae | Peltogyne paniculata | Ref. |
| Plantae | Fabaceae | Peltogyne porphyrocardia | Ref. |
| Plantae | Fabaceae | Peltogyne pubescens | Ref. |
| Plantae | Fabaceae | Peltogyne recifensis | Ref. |
| Plantae | Fabaceae | Peltogyne venosa | Ref. |
| Plantae | Fabaceae | Trachylobium verrucosum | Ref. |
| Plantae | Fabaceae | Umtiza listerana | Ref. |
|
|
zoom in
| Organism | Acacia fasciculifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Drewes,J.Chem.Soc.C.,(1966),1644 |
|---|
|