| Name |
Methylhildgardtol A |
| Formula |
C22H24O4 |
| Mw |
352.16745925 |
| CAS RN |
104777-97-1 |
| C_ID |
C00008985
, 
|
| InChIKey |
KCRBILJKGXMJLI-ZZGIWWCENA-N |
| InChICode |
InChI=1S/C22H24O4/c1-13(2)16-10-15-18(25-16)12-20(24-4)21-19(23-3)11-17(26-22(15)21)14-8-6-5-7-9-14/h5-9,12,16-17,19H,1,10-11H2,2-4H3/t16-,17-,19+/m0/s1 |
| SMILES |
C=C(C)C1Cc2c(cc(OC)c3c2O[C@H](c2ccccc2)C[C@H]3OC)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia silvestris | Ref. |
| Plantae | Fabaceae | Acacia terminalis | Ref. |
| Plantae | Fabaceae | Tephrosia hildebrandtii | Ref. |
|
|
zoom in
| Organism | Tephrosia hildebrandtii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Phytochem.,25,(1986),1711 |
|---|
|