| Name |
Epicatechin 3-O-beta-D-allopyranoside |
| Formula |
C21H24O11 |
| Mw |
452.13186161 |
| CAS RN |
98819-14-8 |
| C_ID |
C00008838
, 
|
| InChIKey |
YOVYWMDLYSJYPO-MGTYQCCUNA-N |
| InChICode |
InChI=1S/C21H24O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-5,15-29H,6-7H2/t15-,16-,17-,18+,19-,20-,21-/m1/s1 |
| SMILES |
OC[C@H]1O[C@@H](O[C@@H]2Cc3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Davalliaceae | Davallia divaricata | Ref. |
| Plantae | Davalliaceae | Davallia griffithiana | Ref. |
| Plantae | Davalliaceae | Davallia maries | Ref. |
|
|
zoom in
| Organism | Davallia maries | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Murakami,Yakugaku Zasshi,105,(1985),649
Hwang,Phytochem.,29,(1990),279 |
|---|
|