| Name |
Mesquitol |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
109671-55-8 |
| C_ID |
C00008827
, 
|
| InChIKey |
TXULLYMENMRLHL-XGJSPVFONA-N |
| InChICode |
InChI=1S/C15H14O6/c16-9-3-1-7(5-11(9)18)14-12(19)6-8-2-4-10(17)13(20)15(8)21-14/h1-5,12,14,16-20H,6H2/t12-,14+/m0/s1 |
| SMILES |
Oc1ccc([C@H]2Oc3c(ccc(O)c3O)C[C@@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
| Plantae | Fabaceae | Prosopis glandulosa | Ref. |
|
|
zoom in
| Organism | Prosopis glandulosa |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Miyauchi,Mokuzai Gakkaishi,22,(1976),47
Jacobs,Tetrahedron Lett.,24,(1983),4627 |
|---|
|
