| Name |
Hildgardtene |
| Formula |
C21H20O4 |
| Mw |
336.13615913 |
| CAS RN |
104777-96-0 |
| C_ID |
C00008793
, 
|
| InChIKey |
ILWIXDUFMCFWAS-XMMHCCIVNA-N |
| InChICode |
InChI=1S/C21H20O4/c1-12(2)16-9-14-18(24-16)11-19(23-3)20-15(22)10-17(25-21(14)20)13-7-5-4-6-8-13/h4-8,11,16-17H,1,9-10H2,2-3H3/t16-,17+/m1/s1 |
| SMILES |
C=C(C)C1Cc2c(cc(OC)c3c2O[C@H](c2ccccc2)CC3=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Tephrosia abbottiae | Ref. |
| Plantae | Fabaceae | Tephrosia emoroides | Ref. |
| Plantae | Fabaceae | Tephrosia hildebrandtii | Ref. |
|
|
zoom in
| Organism | Tephrosia hildebrandtii |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Phytochem.,25,(1986),1711
Gomez-Garibay,Chem.Ind.(London),(1986),827 |
|---|
|
