| Name |
7,4'-Dihydroxy-3'-methoxyflavan |
| Formula |
C16H16O4 |
| Mw |
272.104859 |
| CAS RN |
95587-88-5 |
| C_ID |
C00008759
, 
|
| InChIKey |
GJBQOEWAEONRFS-YQTOOIBONA-N |
| InChICode |
InChI=1S/C16H16O4/c1-19-16-8-11(3-6-13(16)18)14-7-4-10-2-5-12(17)9-15(10)20-14/h2-3,5-6,8-9,14,17-18H,4,7H2,1H3/t14-/m0/s1 |
| SMILES |
COc1cc([C@@H]2CCc3ccc(O)cc3O2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Zephyranthes flava | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Dracaenaceae | Dracaena draco  | Ref. |
| Plantae | Fabaceae | Bauhinia manca | Ref. |
|
|
zoom in
| Organism | Dracaena draco | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Braz Filho,Phytochem.,19,(1980),455
Camarda,Heterocycles,20,(1983),39 |
|---|
|