| Name |
Aromadendrin 3-glucoside |
| Formula |
C21H22O11 |
| Mw |
450.11621155 |
| CAS RN |
31049-08-8 |
| C_ID |
C00008671
, 
|
| InChIKey |
VWBWQPAZMNABMR-ZNMZPUJDNA-N |
| InChICode |
InChI=1S/C21H22O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-26,28-29H,7H2/t13-,15-,17+,18-,19+,20-,21+/m1/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O[C@@H]1OC(CO)[C@@H](O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Podocarpaceae | Podocarpus nivalis | Ref. |
| Plantae | Rosaceae | Malus sylvestris  | Ref. |
|
|
zoom in
| Organism | Malus sylvestris | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 797,Flavanones and dihydroflavonols
Dayal,Planta Med.,31,(1977),245
Markham,N.Z.J.Bot.,23,(1985),1 |
|---|
|