| Name |
Sanggenon A |
| Formula |
C25H24O7 |
| Mw |
436.15220312 |
| CAS RN |
76464-71-6 |
| C_ID |
C00008628
, 
|
| InChIKey |
GPSKVSZZHKDRDQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H24O7/c1-13(2)7-10-24-22(28)20-19(12-17-15(21(20)27)8-9-23(3,4)30-17)32-25(24,29)16-6-5-14(26)11-18(16)31-24/h5-9,11-12,26-27,29H,10H2,1-4H3/t24-,25+/m1/s1 |
| SMILES |
CC(C)=CCC12Oc3cc(O)ccc3C1(O)Oc1cc3c(c(O)c1C2=O)C=CC(C)(C)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Morus mongolica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 750,Flavanones and dihydroflavonols
Nomura,Planta Med.,47,(1983),30
Nomura,Prog.Chem.Org.Nat.Prod.,53,(1988),87 |
|---|
|