| Name |
Sophoraflavanone I |
| Formula |
C39H38O9 |
| Mw |
650.25158281 |
| CAS RN |
136997-69-8 |
| C_ID |
C00008525
, 
|
| InChIKey |
DBXQAEOPCKROBN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C39H38O9/c1-19(2)5-6-22(20(3)4)13-28-30(43)16-32(45)37-33(46)18-34(48-39(28)37)27-15-29-35(17-31(27)44)47-38(21-7-9-24(40)10-8-21)36(29)23-11-25(41)14-26(42)12-23/h5,7-12,14-17,22,34,36,38,40-45H,3,6,13,18H2,1-2,4H3/t22-,34+,36-,38+/m1/s1 |
| SMILES |
C=C(C)C(CC=C(C)C)Cc1c(O)cc(O)c2c1OC(c1cc3c(cc1O)OC(c1ccc(O)cc1)C3c1cc(O)cc(O)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Sophora davidii | Ref. |
| Plantae | Fabaceae | Sophora leachiana | Ref. |
| Plantae | Fabaceae | Sophora moorcroftiana  | Ref. |
|
|
zoom in
| Organism | Sophora moorcroftiana |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 638,Flavanones and dihydroflavonols
Iinuma,Phytochem.,30,(1991),3773 |
|---|
|
