| Name |
5,7,3',4'-Tetrahydroxy-6,8-di-C-prenylflavanone 6,8-Diprenyleriodictyol |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
151649-32-0 |
| C_ID |
C00008496
, 
|
| InChIKey |
WWFVAIXZPACOBJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O6/c1-13(2)5-8-16-23(29)17(9-6-14(3)4)25-22(24(16)30)20(28)12-21(31-25)15-7-10-18(26)19(27)11-15/h5-7,10-11,21,26-27,29-30H,8-9,12H2,1-4H3/t21-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)CC(c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Dorstenia mannii | Ref. |
| Plantae | Muntingiaceae | Muntingia calabura  | Ref. |
| Plantae | Velloziaceae | Vellozia coronata | Ref. |
| Plantae | Velloziaceae | Vellozia nanuzae | Ref. |
|
|
zoom in
| Organism | Vellozia coronata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 612,Flavanones and dihydroflavonols
Harborne,Phytochem.,34,(1993),219 |
|---|
|