| Name |
(2S)-5,7,2'-Trihydroxyflavanone 5,7,2'-Trihydroxyflavanone |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
111199-94-1 |
| C_ID |
C00008478
, 
|
| InChIKey |
LSLXUDALHVEMQB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O5/c16-8-5-11(18)15-12(19)7-13(20-14(15)6-8)9-3-1-2-4-10(9)17/h1-6,13,16-18H,7H2/t13-/m0/s1 |
| SMILES |
O=C1CC(c2ccccc2O)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Galenia africana  | Ref. |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
|
|
zoom in
| Organism | Scutellaria indica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 595,Flavanones and dihydroflavonols
Chou,T'ai-wan Yao Hsueh Tsa Chih,38,(1986),107
Miyaichi,Chem.Parm.Bull.,37,(1989),794 |
|---|
|