| Name |
Sigmoidin F |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
126005-97-8 |
| C_ID |
C00008465
, 
|
| InChIKey |
WPVMLODCRMLWMB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-6-16-17(9-14-7-8-25(3,4)31-24(14)23(16)29)20-12-19(28)22-18(27)10-15(26)11-21(22)30-20/h5,7-11,20,26-27,29H,6,12H2,1-4H3/t20-/m1/s1 |
| SMILES |
CC(C)=CCc1c(C2CC(=O)c3c(O)cc(O)cc3O2)cc2c(c1O)OC(C)(C)C=C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
|
|
zoom in
| Organism | Erythrina sigmoidea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 582,Flavanones and dihydroflavonols
Promsattha,J.Nat.Prod.,52,(1989),1316 |
|---|
|