| Name |
Glabrol |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
59870-65-4 |
| C_ID |
C00008459
, 
|
| InChIKey |
CUFAXDWQDQQKFF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O4/c1-15(2)5-7-17-13-18(8-11-21(17)26)24-14-23(28)20-10-12-22(27)19(25(20)29-24)9-6-16(3)4/h5-6,8,10-13,24,26-27H,7,9,14H2,1-4H3/t24-/m1/s1 |
| SMILES |
CC(C)=CCc1cc(C2CC(=O)c3ccc(O)c(CC=C(C)C)c3O2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Euchresta horsfeldii | Ref. |
| Plantae | Fabaceae | Euchresta japonica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Sophora alopecuroides | Ref. |
| Plantae | Fabaceae | Sophora prostrata | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 575,Flavanones and dihydroflavonols
Saito,Chem.Pharm.Bull.,24,(1976),752 |
|---|
|