| Name |
Leachianone A |
| Formula |
C26H30O6 |
| Mw |
438.20423869 |
| CAS RN |
97938-31-3 |
| C_ID |
C00008433
, 
|
| InChIKey |
YLTPWCZXKJSORQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C26H30O6/c1-14(2)6-7-16(15(3)4)10-19-20(28)12-21(29)25-22(30)13-24(32-26(19)25)18-9-8-17(27)11-23(18)31-5/h6,8-9,11-12,16,24,27-29H,3,7,10,13H2,1-2,4-5H3/t16-,24-/m1/s1 |
| SMILES |
C=C(C)C(CC=C(C)C)Cc1c(O)cc(O)c2c1OC(c1ccc(O)cc1OC)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Sophora davidii | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora leachiana | Ref. |
|
|
zoom in
| Organism | Sophora leachiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 549,Flavanones and dihydroflavonols
Iinuma,Phytochem.,29,(1990),2667 |
|---|
|