| Name |
Narirutin 4'-glucoside |
| Formula |
C33H42O19 |
| Mw |
742.23202916 |
| CAS RN |
17257-22-6 |
| C_ID |
C00008386
, 
|
| InChIKey |
KQUWJUNIYQVHCG-SXFMELFENA-N |
| InChICode |
InChI=1S/C33H42O19/c1-11-22(37)25(40)28(43)31(47-11)46-10-20-24(39)27(42)30(45)33(52-20)49-14-6-15(35)21-16(36)8-17(50-18(21)7-14)12-2-4-13(5-3-12)48-32-29(44)26(41)23(38)19(9-34)51-32/h2-7,11,17,19-20,22-35,37-45H,8-10H2,1H3/t11-,17-,19+,20+,22-,23+,24+,25-,26+,27-,28+,29-,30+,31+,32+,33+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc(O)c4c(c3)OC(c3ccc(O[C@@H]5OC(CO)[C@@H](O)C(O)C5O)cc3)CC4=O)C(O)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
| Organism | Citrus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 500,Flavanones and dihydroflavonols
Mizelle,Phytochem.,6,(1967),1305 |
|---|
|