| Name |
Sigmoidin A |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
87746-48-3 |
| C_ID |
C00008319
, 
|
| InChIKey |
BVHLNRAYBCPKOY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O6/c1-13(2)5-7-15-9-18(17(8-6-14(3)4)25(30)24(15)29)21-12-20(28)23-19(27)10-16(26)11-22(23)31-21/h5-6,9-11,21,26-27,29-30H,7-8,12H2,1-4H3/t21-/m1/s1 |
| SMILES |
CC(C)=CCc1cc(C2CC(=O)c3c(O)cc(O)cc3O2)c(CC=C(C)C)c(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
|
|
zoom in
| Organism | Erythrina sigmoidea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 432,Flavanones and dihydroflavonols
Fomum,Tetrahedron Lett.,24,(1983),4127 |
|---|
|