| Name |
8-Prenyleriodictyol |
| Formula |
C20H20O6 |
| Mw |
356.12598837 |
| CAS RN |
80931-11-9 |
| C_ID |
C00008317
, 
|
| InChIKey |
XJUDJFVOICLOMY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O6/c1-10(2)3-5-12-14(22)8-16(24)19-17(25)9-18(26-20(12)19)11-4-6-13(21)15(23)7-11/h3-4,6-8,18,21-24H,5,9H2,1-2H3/t18-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c1OC(c1ccc(O)c(O)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Encelia spp. | Ref. |
| Plantae | Asteraceae | Flourensia fiebrigii | Ref. |
| Plantae | Asteraceae | Wyethia spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Wyethia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 429,Flavanones and dihydroflavonols
Bohlmann,Phytochem.,20,(1981),2245 |
|---|
|