| Name |
Eriocitrin |
| Formula |
C27H32O15 |
| Mw |
596.17412036 |
| CAS RN |
13463-28-0 |
| C_ID |
C00008295
, 
|
| InChIKey |
OMQADRGFMLGFJF-CTNUISCONA-N |
| InChICode |
InChI=1S/C27H32O15/c1-9-20(32)22(34)24(36)26(39-9)38-8-18-21(33)23(35)25(37)27(42-18)40-11-5-14(30)19-15(31)7-16(41-17(19)6-11)10-2-3-12(28)13(29)4-10/h2-6,9,16,18,20-30,32-37H,7-8H2,1H3/t9-,16-,18-,20+,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc(O)c4c(c3)OC(c3ccc(O)c(O)c3)CC4=O)C(O)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Myoporaceae | Myoporum tenuifolium | Ref. |
| Plantae | Myrtaceae | Plinia cauliflora | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
|
|
zoom in
| Organism | Myoporum tenuifolium | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 403,Flavanones and dihydroflavonols
Horowitz,Nature,185,(1960),319
Kamiya,Agric.Biol.Chem.,43,(1979),1529 |
|---|
|