| Name |
Eriodictin |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
480-35-3 |
| C_ID |
C00008292
, 
|
| InChIKey |
JMVXRLMOIOTWSB-ULMVUAKDNA-N |
| InChICode |
InChI=1S/C21H22O10/c1-8-18(26)19(27)20(28)21(29-8)30-10-5-13(24)17-14(25)7-15(31-16(17)6-10)9-2-3-11(22)12(23)4-9/h2-6,8,15,18-24,26-28H,7H2,1H3/t8-,15-,18+,19+,20-,21+/m1/s1 |
| SMILES |
CC1O[C@@H](Oc2cc(O)c3c(c2)OC(c2ccc(O)c(O)c2)CC3=O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
| Plantae | Rutaceae | Citrus limettioides | Ref. |
|
|
zoom in
| Organism | Citrus limettioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 400,Flavanones and dihydroflavonols
Chauhan,Planta Med.,32,(1977),217 |
|---|
|