| Name |
Isoxanthohumol Isoxanthohumol(Sophora) |
| Formula |
C21H22O5 |
| Mw |
354.14672381 |
| CAS RN |
70872-29-6 |
| C_ID |
C00008246
, 
|
| InChIKey |
YKGCBLWILMDSAV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O5/c1-12(2)4-9-15-16(23)10-19(25-3)20-17(24)11-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,10,18,22-23H,9,11H2,1-3H3/t18-/m1/s1 |
| SMILES |
COc1cc(O)c(CC=C(C)C)c2c1C(=O)CC(c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Fabaceae | Sophora angustifolia | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
|
|
zoom in
| Organism | Sophora flavescens | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Lu, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 563.
Chadwick, et al., Journal of Natural Products, 67, (2004), 2024 |
|---|
|