| Name |
5-Hydroxy-7-methoxy-6,8-di-C-methylflavanone |
| Formula |
C18H18O4 |
| Mw |
298.12050906 |
| CAS RN |
55820-35-4 |
| C_ID |
C00008169
, 
|
| InChIKey |
KZNAGLGLKRUIPD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H18O4/c1-10-16(20)15-13(19)9-14(12-7-5-4-6-8-12)22-18(15)11(2)17(10)21-3/h4-8,14,20H,9H2,1-3H3/t14-/m0/s1 |
| SMILES |
COc1c(C)c(O)c2c(c1C)OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Unona lawii | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
| Plantae | Piperaceae | Piper hostmannianum | Ref. |
|
|
zoom in
| Organism | Piper hostmannianum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 264,Flavanones and dihydroflavonols
Joshi,Indian J.Chem.Sect.B.,12,(1974),1033
Mayer,Phytochem.,29,(1990),1340 |
|---|
|
