| Name |
Desmethoxymatteucinol |
| Formula |
C17H16O4 |
| Mw |
284.104859 |
| CAS RN |
56297-79-1 |
| C_ID |
C00008168
, 
|
| InChIKey |
HAIHGFWQOPJMPV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O4/c1-9-15(19)10(2)17-14(16(9)20)12(18)8-13(21-17)11-6-4-3-5-7-11/h3-7,13,19-20H,8H2,1-2H3/t13-/m1/s1 |
| SMILES |
Cc1c(O)c(C)c2c(c1O)C(=O)CC(c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria afzelii | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ericaceae | Ceratiola ericoides | Ref. |
| Plantae | Fabaceae | Bauhinia purpurea  | Ref. |
| Plantae | Fabaceae | Psorothamnus polydenius | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
|
|
zoom in
| Organism | Ceratiola ericoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 263,Flavanones and dihydroflavonols
Fujise,Sci.Papers Inst.Phys.Chem.Res.(Tokyo),11,(1929),111 |
|---|
|