| Name |
Calomelanone |
| Formula |
C17H18O5 |
| Mw |
302.11542369 |
| CAS RN |
35241-54-4 |
| C_ID |
C00007939
, 
|
| InChIKey |
VVDZZNWYISOIDK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H18O5/c1-21-12-6-3-11(4-7-12)5-8-14(18)17-15(19)9-13(22-2)10-16(17)20/h3-4,6-7,9-10,19-20H,5,8H2,1-2H3 |
| SMILES |
COc1ccc(CCC(=O)c2c(O)cc(OC)cc2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Notholaena sulphurea | Ref. |
| Plantae | Pteridaceae | Pityrogramma calomelanos  | Ref. |
| Plantae | Pteridaceae | Pityrogramma chrysophylla  | Ref. |
| Plantae | Pteridaceae | Pityrogramma tartarea | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Salicaceae | Populus x jackii | Ref. |
|
|
zoom in
| Organism | Pityrogramma chrysophylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Nilsson,Acata Chem.Scand.,15,(1961),154
Star,Phytochem.,10,(1971),2817 |
|---|
|