| Name |
Methylglyoxal |
| Formula |
C3H4O2 |
| Mw |
72.02112937 |
| CAS RN |
78-98-8 |
| C_ID |
C00007562
, 
|
| InChIKey |
AIJULSRZWUXGPQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H4O2/c1-3(5)2-4/h2H,1H3 |
| SMILES |
CC(=O)C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|