| Name |
Tridecanoic acid |
| Formula |
C13H26O2 |
| Mw |
214.19328007 |
| CAS RN |
638-53-9 |
| C_ID |
C00007422
, 
|
| InChIKey |
SZHOJFHSIKHZHA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15) |
| SMILES |
CCCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Jubulaceae | Frullania pycnantha | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Angelica dahurica | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|