| Name |
D-Xylose Xylose D-(+)-Xylose |
| Formula |
C5H10O5 |
| Mw |
150.05282343 |
| CAS RN |
58-86-6 |
| C_ID |
C00007290
, 
|
| InChIKey |
SRBFZHDQGSBBOR-WMJLAQOENA-N |
| InChICode |
InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m1/s1 |
| SMILES |
O[C@@H]1[C@@H](O)[C@@H](O)OC[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis canescens | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tubulosa | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Fabaceae | Acacia tortuosa | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Typhaceae | Typha angustifolia  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Panax ginseng | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|