| Name |
5-Dehydroepisterol 24-Methylcholesta-5,7,24(28)-trienol Ergosta-5,7,24(28)-trien-3beta-ol |
| Formula |
C28H44O |
| Mw |
396.33921603 |
| CAS RN |
23582-83-4 |
| C_ID |
C00007261
, 
|
| InChIKey |
ZEPNVCGPJXYABB-MCVQFUOHNA-N |
| InChICode |
InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9-10,18,20,22,24-26,29H,3,7-8,11-17H2,1-2,4-6H3/t20-,22+,24-,25+,26+,27+,28-/m1/s1 |
| SMILES |
C=C(CC[C@@H](C)C1CCC2C3=CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Phaeosphaeriaceae | Leptosphaeria typhae | Ref. |
| Fungi | Phycomycetaceae | Phycomyces blakesleeanus | Ref. |
| Fungi | Saccharomycetaceae | Candida albicans | Ref. |
| Fungi | Saccharomycetaceae | Candida utilis | Ref. |
| Fungi | Saccharomycetaceae | Saccharomyces carlsbergensis | Ref. |
| Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
|
|
zoom in
| Organism | Candida albicans | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,pp.341(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983) |
|---|
|