| Name |
Licochalcone A |
| Formula |
C21H22O4 |
| Mw |
338.15180919 |
| CAS RN |
58749-22-7 |
| C_ID |
C00007057
, 
|
| InChIKey |
KAZSKMJFUPEHHW-DHZHZOJOSA-N |
| InChICode |
InChI=1S/C21H22O4/c1-5-21(2,3)17-12-15(20(25-4)13-19(17)24)8-11-18(23)14-6-9-16(22)10-7-14/h5-13,22,24H,1H2,2-4H3/b11-8+ |
| SMILES |
C=CC(C)(C)c1cc(/C=C/C(=O)c2ccc(O)cc2)c(OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia helioscopia L.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza eurycarpa | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Saitoh,Tetrahedron Lett.,(1975),4461
Phytochem.,35,(1994),515 |
|---|
|