| Name |
Isocordoin |
| Formula |
C20H20O3 |
| Mw |
308.1412445 |
| CAS RN |
52601-05-5,51619-57-9,55332-93-9 |
| C_ID |
C00007045
, 
|
| InChIKey |
CHWWSUSAPRACBZ-FMIVXFBMSA-N |
| InChICode |
InChI=1S/C20H20O3/c1-14(2)8-10-16-19(22)13-11-17(20(16)23)18(21)12-9-15-6-4-3-5-7-15/h3-9,11-13,22-23H,10H2,1-2H3/b12-9+ |
| SMILES |
CC(C)=CCc1c(O)ccc(C(=O)/C=C/c2ccccc2)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris floribunda  | Ref. |
| Plantae | Fabaceae | Flemingia stricta  | Ref. |
| Plantae | Fabaceae | Lonchocarpus neuroscapha | Ref. |
| Plantae | Fabaceae | Lonchocarpus sericeus | Ref. |
| Plantae | Fabaceae | Tephrosia spinosa | Ref. |
|
|
zoom in
| Organism | Lonchocarpus neuroscapha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
de Lima,Gazz.Chim.Ital.,103,(1973),771
Rao,Curr.Sci.,44,(1975),158 |
|---|
|