| Name |
2',4'-Dihydroxy-6'-methoxy-3',5'-dimethylchalcone |
| Formula |
C18H18O4 |
| Mw |
298.12050906 |
| CAS RN |
65349-31-7 |
| C_ID |
C00007044
, 
|
| InChIKey |
TZEQDSMFACWASC-MDZDMXLPSA-N |
| InChICode |
InChI=1S/C18H18O4/c1-11-16(20)12(2)18(22-3)15(17(11)21)14(19)10-9-13-7-5-4-6-8-13/h4-10,20-21H,1-3H3/b10-9+ |
| SMILES |
COc1c(C)c(O)c(C)c(O)c1C(=O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalea caerulea | Ref. |
| Plantae | Fabaceae | Dalea versicolor | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Myricaceae | Myrica cerifera  | Ref. |
| Plantae | Myricaceae | Myrica gale  | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
| Plantae | Myrtaceae | Cleistocalyx operculatus  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
|
|
zoom in
| Organism | Comptonia peregrina | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Malterud,Phyotchem.,16,(1977),1805
Gonzaler,Phytochem.,31,(1992),2565 |
|---|
|